C25H29N3O5 — CID 17153507
ethyl 2-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate (PubChem CID 17153507) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is ethyl 2-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate.
| Compound Name | ethyl 2-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 17153507 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | ethyl 2-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate |
| SMILES | CCCCN1CC(C(=O)Nc2ccc(C(=O)Nc3ccccc3C(=O)OCC)cc2)CC1=O |
| InChI | InChI=1S/C25H29N3O5/c1-3-5-14-28-16-18(15-22(28)29)24(31)26-19-12-10-17(11-13-19)23(30)27-21-9-7-6-8-20(21)25(32)33-4-2/h6-13,18H,3-5,14-16H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | XCKMNFGFCASHSX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |