C24H27N3O5 — CID 17153521
methyl 4-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate (PubChem CID 17153521) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is methyl 4-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 17153521 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | methyl 4-[[4-[(1-butyl-5-oxopyrrolidine-3-carbonyl)amino]benzoyl]amino]benzoate |
| SMILES | CCCCN1CC(C(=O)Nc2ccc(C(=O)Nc3ccc(C(=O)OC)cc3)cc2)CC1=O |
| InChI | InChI=1S/C24H27N3O5/c1-3-4-13-27-15-18(14-21(27)28)23(30)26-19-9-5-16(6-10-19)22(29)25-20-11-7-17(8-12-20)24(31)32-2/h5-12,18H,3-4,13-15H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | GGKVECZLEWZYFG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |