About CID 171535342
CID 171535342 (PubChem CID 171535342) has the molecular formula C17H20ClO4Si
and a molecular weight of 351.88 g/mol.
Molecular Properties
| Compound Name | CID 171535342 |
| PubChem CID | 171535342 |
| Molecular Formula | C17H20ClO4Si |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | — |
| SMILES | C=CC(=O)OC(c1ccccc1)C(OC(=O)C=C)C(Cl)[Si](C)C |
| InChI | InChI=1S/C17H20ClO4Si/c1-5-13(19)21-15(12-10-8-7-9-11-12)16(17(18)23(3)4)22-14(20)6-2/h5-11,15-17H,1-2H2,3-4H3 |
| InChIKey | KQDYNANJXASYDI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 171535342 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171535342?
The IUPAC name of CID 171535342 (CID 171535342) is not available.
What is the SMILES notation for CID 171535342?
The canonical SMILES for CID 171535342 is C=CC(=O)OC(c1ccccc1)C(OC(=O)C=C)C(Cl)[Si](C)C.
What is the InChIKey of CID 171535342?
The InChIKey is KQDYNANJXASYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClO4Si/c1-5-13(19)21-15(12-10-8-7-9-11-12)16(17(18)23(3)4)22-14(20)6-2/h5-11,15-17H,1-2H2,3-4H3.
What are the key properties of CID 171535342?
CID 171535342 has a molecular weight of 351.88 g/mol, XLogP of 3.46, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171535342 is sourced from PubChem (CID 171535342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).