C19H18F6N4O2 — CID 171536996
1-[3-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one;5-fluoropyrimidin-2-amine (PubChem CID 171536996) has the molecular formula C19H18F6N4O2 and a molecular weight of 448.37 g/mol. Its IUPAC name is 1-[3-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one;5-fluoropyrimidin-2-amine.
| Compound Name | 1-[3-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one;5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 171536996 |
| Molecular Formula | C19H18F6N4O2 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1-[3-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one;5-fluoropyrimidin-2-amine |
| SMILES | C=CC(=O)N1CCC(OC(F)(F)c2ccc(C(F)(F)F)cc2)C1.Nc1ncc(F)cn1 |
| InChI | InChI=1S/C15H14F5NO2.C4H4FN3/c1-2-13(22)21-8-7-12(9-21)23-15(19,20)11-5-3-10(4-6-11)14(16,17)18;5-3-1-7-4(6)8-2-3/h2-6,12H,1,7-9H2;1-2H,(H2,6,7,8) |
| InChIKey | OKNPVJIEJGYNCB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|