About 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline
3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline (PubChem CID 171537389) has the molecular formula C14H7ClF2N2O
and a molecular weight of 292.67 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline.
Molecular Properties
| Compound Name | 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline |
| PubChem CID | 171537389 |
| Molecular Formula | C14H7ClF2N2O |
| Molecular Weight | 292.67 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline |
| SMILES | Fc1cc(F)c2ncc(Oc3ccnc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C14H7ClF2N2O/c15-13-6-10(1-2-18-13)20-11-4-8-3-9(16)5-12(17)14(8)19-7-11/h1-7H |
| InChIKey | NSFKEPAIBYPFKM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline?
The IUPAC name of 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline (CID 171537389) is 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline.
What is the SMILES notation for 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline?
The canonical SMILES for 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline is Fc1cc(F)c2ncc(Oc3ccnc(Cl)c3)cc2c1.
What is the InChIKey of 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline?
The InChIKey is NSFKEPAIBYPFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7ClF2N2O/c15-13-6-10(1-2-18-13)20-11-4-8-3-9(16)5-12(17)14(8)19-7-11/h1-7H.
What are the key properties of 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline?
3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline has a molecular weight of 292.67 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-4-pyridinyl)oxy]-6,8-difluoroquinoline is sourced from PubChem (CID 171537389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).