C20H13F2N3O2 — CID 171537901
4-[4-(4-cyano-2,3-difluorophenoxy)-2-pyridinyl]-2-methylbenzamide (PubChem CID 171537901) has the molecular formula C20H13F2N3O2 and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-[4-(4-cyano-2,3-difluorophenoxy)-2-pyridinyl]-2-methylbenzamide.
| Compound Name | 4-[4-(4-cyano-2,3-difluorophenoxy)-2-pyridinyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 171537901 |
| Molecular Formula | C20H13F2N3O2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-[4-(4-cyano-2,3-difluorophenoxy)-2-pyridinyl]-2-methylbenzamide |
| SMILES | Cc1cc(-c2cc(Oc3ccc(C#N)c(F)c3F)ccn2)ccc1C(N)=O |
| InChI | InChI=1S/C20H13F2N3O2/c1-11-8-12(2-4-15(11)20(24)26)16-9-14(6-7-25-16)27-17-5-3-13(10-23)18(21)19(17)22/h2-9H,1H3,(H2,24,26) |
| InChIKey | FRHKUZHLCCMBCC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |