C19H25FN2O2 — CID 171537977
3-amino-N-[(4-fluorophenyl)methyl]-4-(2-hydroxypropan-2-yl)benzamide;ethane (PubChem CID 171537977) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 3-amino-N-[(4-fluorophenyl)methyl]-4-(2-hydroxypropan-2-yl)benzamide;ethane.
| Compound Name | 3-amino-N-[(4-fluorophenyl)methyl]-4-(2-hydroxypropan-2-yl)benzamide;ethane |
|---|---|
| PubChem CID | 171537977 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 3-amino-N-[(4-fluorophenyl)methyl]-4-(2-hydroxypropan-2-yl)benzamide;ethane |
| SMILES | CC.CC(C)(O)c1ccc(C(=O)NCc2ccc(F)cc2)cc1N |
| InChI | InChI=1S/C17H19FN2O2.C2H6/c1-17(2,22)14-8-5-12(9-15(14)19)16(21)20-10-11-3-6-13(18)7-4-11;1-2/h3-9,22H,10,19H2,1-2H3,(H,20,21);1-2H3 |
| InChIKey | CKCQLYRSGFHZGR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|