C18H18ClN5O3 — CID 171539175
N-(3-amino-3-oxopropyl)-5-[2-(prop-2-enoylamino)ethynyl]-1H-pyrazole-4-carboxamide;chlorobenzene (PubChem CID 171539175) has the molecular formula C18H18ClN5O3 and a molecular weight of 387.83 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-5-[2-(prop-2-enoylamino)ethynyl]-1H-pyrazole-4-carboxamide;chlorobenzene.
| Compound Name | N-(3-amino-3-oxopropyl)-5-[2-(prop-2-enoylamino)ethynyl]-1H-pyrazole-4-carboxamide;chlorobenzene |
|---|---|
| PubChem CID | 171539175 |
| Molecular Formula | C18H18ClN5O3 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-5-[2-(prop-2-enoylamino)ethynyl]-1H-pyrazole-4-carboxamide;chlorobenzene |
| SMILES | C=CC(=O)NC#Cc1[nH]ncc1C(=O)NCCC(N)=O.Clc1ccccc1 |
| InChI | InChI=1S/C12H13N5O3.C6H5Cl/c1-2-11(19)14-5-3-9-8(7-16-17-9)12(20)15-6-4-10(13)18;7-6-4-2-1-3-5-6/h2,7H,1,4,6H2,(H2,13,18)(H,14,19)(H,15,20)(H,16,17);1-5H |
| InChIKey | MGMXNFCHROFRTB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|