C23H26FN5O — CID 171540297
N-[(3R)-1-(3-fluoroisoquinolin-1-yl)piperidin-3-yl]-4-morpholin-4-ylpyridin-2-amine (PubChem CID 171540297) has the molecular formula C23H26FN5O and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[(3R)-1-(3-fluoroisoquinolin-1-yl)piperidin-3-yl]-4-morpholin-4-ylpyridin-2-amine.
| Compound Name | N-[(3R)-1-(3-fluoroisoquinolin-1-yl)piperidin-3-yl]-4-morpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 171540297 |
| Molecular Formula | C23H26FN5O |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-[(3R)-1-(3-fluoroisoquinolin-1-yl)piperidin-3-yl]-4-morpholin-4-ylpyridin-2-amine |
| SMILES | Fc1cc2ccccc2c(N2CCC[C@@H](Nc3cc(N4CCOCC4)ccn3)C2)n1 |
| InChI | InChI=1S/C23H26FN5O/c24-21-14-17-4-1-2-6-20(17)23(27-21)29-9-3-5-18(16-29)26-22-15-19(7-8-25-22)28-10-12-30-13-11-28/h1-2,4,6-8,14-15,18H,3,5,9-13,16H2,(H,25,26)/t18-/m1/s1 |
| InChIKey | HCTBHMNJXLWTOC-GOSISDBHSA-N |
| XLogP | 3.69 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|