C50H93NO5 — CID 171541849
[(E)-6-[6-[2-[(Z)-hex-1-enyl]decanoyloxy]hexyl-(2-hydroxycyclohexyl)amino]hex-3-enyl] 2-hexyldecanoate (PubChem CID 171541849) has the molecular formula C50H93NO5 and a molecular weight of 788.30 g/mol. Its IUPAC name is [(E)-6-[6-[2-[(Z)-hex-1-enyl]decanoyloxy]hexyl-(2-hydroxycyclohexyl)amino]hex-3-enyl] 2-hexyldecanoate.
| Compound Name | [(E)-6-[6-[2-[(Z)-hex-1-enyl]decanoyloxy]hexyl-(2-hydroxycyclohexyl)amino]hex-3-enyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 171541849 |
| Molecular Formula | C50H93NO5 |
| Molecular Weight | 788.30 g/mol |
| Exact Mass | 787.71 |
| IUPAC Name | [(E)-6-[6-[2-[(Z)-hex-1-enyl]decanoyloxy]hexyl-(2-hydroxycyclohexyl)amino]hex-3-enyl] 2-hexyldecanoate |
| SMILES | CCCC/C=C\C(CCCCCCCC)C(=O)OCCCCCCN(CC/C=C/CCOC(=O)C(CCCCCC)CCCCCCCC)C1CCCCC1O |
| InChI | InChI=1S/C50H93NO5/c1-5-9-13-17-19-27-37-45(35-25-15-11-7-3)49(53)55-43-33-23-21-31-41-51(47-39-29-30-40-48(47)52)42-32-22-24-34-44-56-50(54)46(36-26-16-12-8-4)38-28-20-18-14-10-6-2/h21,23,26,36,45-48,52H,5-20,22,24-25,27-35,37-44H2,1-4H3/b23-21+,36-26- |
| InChIKey | JGTGUILMMMIBBX-SCRUSGBWSA-N |
| XLogP | 14.03 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.30 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|