C23H31N3O5S2 — CID 17154220
N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-3-[(4-methylphenyl)sulfonylamino]propanamide (PubChem CID 17154220) has the molecular formula C23H31N3O5S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-3-[(4-methylphenyl)sulfonylamino]propanamide.
| Compound Name | N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-3-[(4-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17154220 |
| Molecular Formula | C23H31N3O5S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-3-[(4-methylphenyl)sulfonylamino]propanamide |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(NC(=O)CCNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H31N3O5S2/c1-3-20-6-4-5-17-26(20)33(30,31)22-13-9-19(10-14-22)25-23(27)15-16-24-32(28,29)21-11-7-18(2)8-12-21/h7-14,20,24H,3-6,15-17H2,1-2H3,(H,25,27) |
| InChIKey | PIERIGIHPSKACB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |