C30H33N5O2 — CID 171543881
(3R)-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide (PubChem CID 171543881) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is (3R)-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 171543881 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (3R)-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide |
| SMILES | COc1cccc(-c2nc([C@@H]3CCCN(C(=O)Nc4ccc(N5CCCC5)cc4)C3)n3ccccc23)c1 |
| InChI | InChI=1S/C30H33N5O2/c1-37-26-10-6-8-22(20-26)28-27-11-2-3-19-35(27)29(32-28)23-9-7-18-34(21-23)30(36)31-24-12-14-25(15-13-24)33-16-4-5-17-33/h2-3,6,8,10-15,19-20,23H,4-5,7,9,16-18,21H2,1H3,(H,31,36)/t23-/m1/s1 |
| InChIKey | SDYCQQVYGXCNTR-HSZRJFAPSA-N |
| XLogP | 6.02 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|