C30H35N5O2 — CID 171544152
(3R)-N-[4-(diethylamino)phenyl]-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide (PubChem CID 171544152) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is (3R)-N-[4-(diethylamino)phenyl]-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[4-(diethylamino)phenyl]-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 171544152 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | (3R)-N-[4-(diethylamino)phenyl]-3-[1-(3-methoxyphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)N2CCC[C@@H](c3nc(-c4cccc(OC)c4)c4ccccn34)C2)cc1 |
| InChI | InChI=1S/C30H35N5O2/c1-4-33(5-2)25-16-14-24(15-17-25)31-30(36)34-18-9-11-23(21-34)29-32-28(27-13-6-7-19-35(27)29)22-10-8-12-26(20-22)37-3/h6-8,10,12-17,19-20,23H,4-5,9,11,18,21H2,1-3H3,(H,31,36)/t23-/m1/s1 |
| InChIKey | BQKYOCKEMSITNV-HSZRJFAPSA-N |
| XLogP | 6.27 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|