C27H29N5O — CID 171544164
N-[4-(dimethylamino)phenyl]-3-(1-phenylimidazo[1,5-a]pyridin-3-yl)piperidine-1-carboxamide (PubChem CID 171544164) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-3-(1-phenylimidazo[1,5-a]pyridin-3-yl)piperidine-1-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-3-(1-phenylimidazo[1,5-a]pyridin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 171544164 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-3-(1-phenylimidazo[1,5-a]pyridin-3-yl)piperidine-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)N2CCCC(c3nc(-c4ccccc4)c4ccccn34)C2)cc1 |
| InChI | InChI=1S/C27H29N5O/c1-30(2)23-15-13-22(14-16-23)28-27(33)31-17-8-11-21(19-31)26-29-25(20-9-4-3-5-10-20)24-12-6-7-18-32(24)26/h3-7,9-10,12-16,18,21H,8,11,17,19H2,1-2H3,(H,28,33) |
| InChIKey | HJWAKABLVIJSLZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|