C33H33N5O — CID 171544249
(3R)-N-[4-(dimethylamino)phenyl]-3-[1-(4-phenylphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide (PubChem CID 171544249) has the molecular formula C33H33N5O and a molecular weight of 515.66 g/mol. Its IUPAC name is (3R)-N-[4-(dimethylamino)phenyl]-3-[1-(4-phenylphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[4-(dimethylamino)phenyl]-3-[1-(4-phenylphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 171544249 |
| Molecular Formula | C33H33N5O |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (3R)-N-[4-(dimethylamino)phenyl]-3-[1-(4-phenylphenyl)imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)N2CCC[C@@H](c3nc(-c4ccc(-c5ccccc5)cc4)c4ccccn34)C2)cc1 |
| InChI | InChI=1S/C33H33N5O/c1-36(2)29-19-17-28(18-20-29)34-33(39)37-21-8-11-27(23-37)32-35-31(30-12-6-7-22-38(30)32)26-15-13-25(14-16-26)24-9-4-3-5-10-24/h3-7,9-10,12-20,22,27H,8,11,21,23H2,1-2H3,(H,34,39)/t27-/m1/s1 |
| InChIKey | BRIFJNXWAIBWDN-HHHXNRCGSA-N |
| XLogP | 7.15 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|