C28H28F3N5O — CID 171543840
(3R)-N-[4-(dimethylamino)phenyl]-3-[1-[2-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide (PubChem CID 171543840) has the molecular formula C28H28F3N5O and a molecular weight of 507.56 g/mol. Its IUPAC name is (3R)-N-[4-(dimethylamino)phenyl]-3-[1-[2-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[4-(dimethylamino)phenyl]-3-[1-[2-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 171543840 |
| Molecular Formula | C28H28F3N5O |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (3R)-N-[4-(dimethylamino)phenyl]-3-[1-[2-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)N2CCC[C@@H](c3nc(-c4ccccc4C(F)(F)F)c4ccccn34)C2)cc1 |
| InChI | InChI=1S/C28H28F3N5O/c1-34(2)21-14-12-20(13-15-21)32-27(37)35-16-7-8-19(18-35)26-33-25(24-11-5-6-17-36(24)26)22-9-3-4-10-23(22)28(29,30)31/h3-6,9-15,17,19H,7-8,16,18H2,1-2H3,(H,32,37)/t19-/m1/s1 |
| InChIKey | AXQNHPKGGPZSCF-LJQANCHMSA-N |
| XLogP | 6.50 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|