C29H32F3N5O — CID 171543843
3-[1-[3-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carbaldehyde;1-N,4-N,4-N-trimethylbenzene-1,4-diamine (PubChem CID 171543843) has the molecular formula C29H32F3N5O and a molecular weight of 523.60 g/mol. Its IUPAC name is 3-[1-[3-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carbaldehyde;1-N,4-N,4-N-trimethylbenzene-1,4-diamine.
| Compound Name | 3-[1-[3-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carbaldehyde;1-N,4-N,4-N-trimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 171543843 |
| Molecular Formula | C29H32F3N5O |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 3-[1-[3-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridin-3-yl]piperidine-1-carbaldehyde;1-N,4-N,4-N-trimethylbenzene-1,4-diamine |
| SMILES | CNc1ccc(N(C)C)cc1.O=CN1CCCC(c2nc(-c3cccc(C(F)(F)F)c3)c3ccccn23)C1 |
| InChI | InChI=1S/C20H18F3N3O.C9H14N2/c21-20(22,23)16-7-3-5-14(11-16)18-17-8-1-2-10-26(17)19(24-18)15-6-4-9-25(12-15)13-27;1-10-8-4-6-9(7-5-8)11(2)3/h1-3,5,7-8,10-11,13,15H,4,6,9,12H2;4-7,10H,1-3H3 |
| InChIKey | DSDRZDAONIVEFO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|