C27H29N4O2Sn — CID 171543822
CID 171543822 (PubChem CID 171543822) has the molecular formula C27H29N4O2Sn and a molecular weight of 560.27 g/mol.
| Compound Name | CID 171543822 |
|---|---|
| PubChem CID | 171543822 |
| Molecular Formula | C27H29N4O2Sn |
| Molecular Weight | 560.27 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | — |
| SMILES | COc1cccc(-c2nc([C@H]3CCC[Sn]3C(=O)Nc3ccc(N(C)C)cc3)n3ccccc23)c1 |
| InChI | InChI=1S/C18H18N2O.C9H11N2O.Sn/c1-3-4-11-17-19-18(16-10-5-6-12-20(16)17)14-8-7-9-15(13-14)21-2;1-11(2)9-5-3-8(4-6-9)10-7-12;/h5-13H,1,3-4H2,2H3;3-6H,1-2H3,(H,10,12); |
| InChIKey | BVSRIKFCWOTULJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.27 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|