C18H20N4O — CID 171543964
3-(3-methoxyphenyl)-1-[(3R)-piperidin-3-yl]pyrazolo[5,4-b]pyridine (PubChem CID 171543964) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-[(3R)-piperidin-3-yl]pyrazolo[5,4-b]pyridine.
| Compound Name | 3-(3-methoxyphenyl)-1-[(3R)-piperidin-3-yl]pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 171543964 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-[(3R)-piperidin-3-yl]pyrazolo[5,4-b]pyridine |
| SMILES | COc1cccc(-c2nn([C@@H]3CCCNC3)c3ncccc23)c1 |
| InChI | InChI=1S/C18H20N4O/c1-23-15-7-2-5-13(11-15)17-16-8-4-10-20-18(16)22(21-17)14-6-3-9-19-12-14/h2,4-5,7-8,10-11,14,19H,3,6,9,12H2,1H3/t14-/m1/s1 |
| InChIKey | BFHJXPICUVSUTK-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |