C22H18F2N6O3 — CID 150994307
3-[2-fluoro-4-(3-fluoro-2-nitrophenoxy)phenyl]-1-piperidin-3-ylpyrazolo[3,4-d]pyrimidine (PubChem CID 150994307) has the molecular formula C22H18F2N6O3 and a molecular weight of 452.42 g/mol. Its IUPAC name is 3-[2-fluoro-4-(3-fluoro-2-nitrophenoxy)phenyl]-1-piperidin-3-ylpyrazolo[3,4-d]pyrimidine.
| Compound Name | 3-[2-fluoro-4-(3-fluoro-2-nitrophenoxy)phenyl]-1-piperidin-3-ylpyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 150994307 |
| Molecular Formula | C22H18F2N6O3 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 3-[2-fluoro-4-(3-fluoro-2-nitrophenoxy)phenyl]-1-piperidin-3-ylpyrazolo[3,4-d]pyrimidine |
| SMILES | O=[N+]([O-])c1c(F)cccc1Oc1ccc(-c2nn(C3CCCNC3)c3ncncc23)c(F)c1 |
| InChI | InChI=1S/C22H18F2N6O3/c23-17-4-1-5-19(21(17)30(31)32)33-14-6-7-15(18(24)9-14)20-16-11-26-12-27-22(16)29(28-20)13-3-2-8-25-10-13/h1,4-7,9,11-13,25H,2-3,8,10H2 |
| InChIKey | LSTMYMRGXQEWQG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|