C25H24FN5O — CID 130426911
3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine (PubChem CID 130426911) has the molecular formula C25H24FN5O and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine.
| Compound Name | 3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 130426911 |
| Molecular Formula | C25H24FN5O |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine |
| SMILES | C=CCN1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3F)c3cncnc32)C1 |
| InChI | InChI=1S/C25H24FN5O/c1-2-12-30-13-6-7-18(16-30)31-25-22(15-27-17-28-25)24(29-31)21-11-10-20(14-23(21)26)32-19-8-4-3-5-9-19/h2-5,8-11,14-15,17-18H,1,6-7,12-13,16H2/t18-/m1/s1 |
| InChIKey | LDICDIPWJFGDFP-GOSISDBHSA-N |
| XLogP | 5.25 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|