C25H25N5O — CID 130427009
3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine (PubChem CID 130427009) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine.
| Compound Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 130427009 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidine |
| SMILES | C=CCN1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3)c3cncnc32)C1 |
| InChI | InChI=1S/C25H25N5O/c1-2-14-29-15-6-7-20(17-29)30-25-23(16-26-18-27-25)24(28-30)19-10-12-22(13-11-19)31-21-8-4-3-5-9-21/h2-5,8-13,16,18,20H,1,6-7,14-15,17H2/t20-/m1/s1 |
| InChIKey | VCUWWHCPGXJYNZ-HXUWFJFHSA-N |
| XLogP | 5.11 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|