C23H24F2N6O2 — CID 171545008
6-fluoro-5-[4-[(3-fluoro-11-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 171545008) has the molecular formula C23H24F2N6O2 and a molecular weight of 454.48 g/mol. Its IUPAC name is 6-fluoro-5-[4-[(3-fluoro-11-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-fluoro-5-[4-[(3-fluoro-11-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 171545008 |
| Molecular Formula | C23H24F2N6O2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 6-fluoro-5-[4-[(3-fluoro-11-methyl-10-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3cc4c5c(c3)c(F)cn5C(C)C(=O)N4)CC2)c(F)n1 |
| InChI | InChI=1S/C23H24F2N6O2/c1-13-22(32)28-18-10-14(9-15-16(24)12-31(13)20(15)18)11-29-5-7-30(8-6-29)19-4-3-17(23(33)26-2)27-21(19)25/h3-4,9-10,12-13H,5-8,11H2,1-2H3,(H,26,33)(H,28,32) |
| InChIKey | FPFIRYKJDPZIMZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|