C22H23F2N7O2 — CID 176874617
6-fluoro-5-[4-[(9-fluoro-5-methyl-6-oxo-1,2,7-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-10-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 176874617) has the molecular formula C22H23F2N7O2 and a molecular weight of 455.47 g/mol. Its IUPAC name is 6-fluoro-5-[4-[(9-fluoro-5-methyl-6-oxo-1,2,7-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-10-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-fluoro-5-[4-[(9-fluoro-5-methyl-6-oxo-1,2,7-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-10-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176874617 |
| Molecular Formula | C22H23F2N7O2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 6-fluoro-5-[4-[(9-fluoro-5-methyl-6-oxo-1,2,7-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-10-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3cn4ncc5c4c(c3F)NC(=O)C5C)CC2)c(F)n1 |
| InChI | InChI=1S/C22H23F2N7O2/c1-12-14-9-26-31-11-13(17(23)18(19(14)31)28-21(12)32)10-29-5-7-30(8-6-29)16-4-3-15(22(33)25-2)27-20(16)24/h3-4,9,11-12H,5-8,10H2,1-2H3,(H,25,33)(H,28,32) |
| InChIKey | BCBQLMJBGXYTIE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|