C20H33NO4S — CID 171546120
N-[(4-acetylcyclohexyl)methyl]-N-methyl-2-(4-methyl-3-oxopentyl)sulfanyl-4-oxobutanamide (PubChem CID 171546120) has the molecular formula C20H33NO4S and a molecular weight of 383.55 g/mol. Its IUPAC name is N-[(4-acetylcyclohexyl)methyl]-N-methyl-2-(4-methyl-3-oxopentyl)sulfanyl-4-oxobutanamide.
| Compound Name | N-[(4-acetylcyclohexyl)methyl]-N-methyl-2-(4-methyl-3-oxopentyl)sulfanyl-4-oxobutanamide |
|---|---|
| PubChem CID | 171546120 |
| Molecular Formula | C20H33NO4S |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-[(4-acetylcyclohexyl)methyl]-N-methyl-2-(4-methyl-3-oxopentyl)sulfanyl-4-oxobutanamide |
| SMILES | CC(=O)C1CCC(CN(C)C(=O)C(CC=O)SCCC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C20H33NO4S/c1-14(2)18(24)10-12-26-19(9-11-22)20(25)21(4)13-16-5-7-17(8-6-16)15(3)23/h11,14,16-17,19H,5-10,12-13H2,1-4H3 |
| InChIKey | MZLZDELZUYPGEH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|