C28H29ClN4 — CID 171548911
(3S)-1-benzyl-N-[4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenyl]-N-methylpyrrolidin-3-amine (PubChem CID 171548911) has the molecular formula C28H29ClN4 and a molecular weight of 457.02 g/mol. Its IUPAC name is (3S)-1-benzyl-N-[4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenyl]-N-methylpyrrolidin-3-amine.
| Compound Name | (3S)-1-benzyl-N-[4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenyl]-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 171548911 |
| Molecular Formula | C28H29ClN4 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (3S)-1-benzyl-N-[4-[4-(4-chlorophenyl)-5-methyl-1H-imidazol-2-yl]phenyl]-N-methylpyrrolidin-3-amine |
| SMILES | Cc1[nH]c(-c2ccc(N(C)[C@H]3CCN(Cc4ccccc4)C3)cc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H29ClN4/c1-20-27(22-8-12-24(29)13-9-22)31-28(30-20)23-10-14-25(15-11-23)32(2)26-16-17-33(19-26)18-21-6-4-3-5-7-21/h3-15,26H,16-19H2,1-2H3,(H,30,31)/t26-/m0/s1 |
| InChIKey | VVFJWOHRAXBMTF-SANMLTNESA-N |
| XLogP | 6.42 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|