About benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane
benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane (PubChem CID 171550629) has the molecular formula C15H16ClNO3
and a molecular weight of 293.75 g/mol. Its IUPAC name is benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane.
Molecular Properties
| Compound Name | benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane |
| PubChem CID | 171550629 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane |
| SMILES | CC.O=C(/C=C/c1coc(Cl)n1)OCc1ccccc1 |
| InChI | InChI=1S/C13H10ClNO3.C2H6/c14-13-15-11(9-18-13)6-7-12(16)17-8-10-4-2-1-3-5-10;1-2/h1-7,9H,8H2;1-2H3/b7-6+; |
| InChIKey | JRPGQGHXFNNEDZ-UHDJGPCESA-N |
| XLogP | 4.11 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane?
The IUPAC name of benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane (CID 171550629) is benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane.
What is the SMILES notation for benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane?
The canonical SMILES for benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane is CC.O=C(/C=C/c1coc(Cl)n1)OCc1ccccc1.
What is the InChIKey of benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane?
The InChIKey is JRPGQGHXFNNEDZ-UHDJGPCESA-N. The full InChI is InChI=1S/C13H10ClNO3.C2H6/c14-13-15-11(9-18-13)6-7-12(16)17-8-10-4-2-1-3-5-10;1-2/h1-7,9H,8H2;1-2H3/b7-6+;.
What are the key properties of benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane?
benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane has a molecular weight of 293.75 g/mol, XLogP of 4.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (E)-3-(2-chloro-1,3-oxazol-4-yl)prop-2-enoate;ethane is sourced from PubChem (CID 171550629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).