C21H23N9O — CID 171551155
N,1-dimethyl-3-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclobutane-1-carboxamide (PubChem CID 171551155) has the molecular formula C21H23N9O and a molecular weight of 417.48 g/mol. Its IUPAC name is N,1-dimethyl-3-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclobutane-1-carboxamide.
| Compound Name | N,1-dimethyl-3-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 171551155 |
| Molecular Formula | C21H23N9O |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N,1-dimethyl-3-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclobutane-1-carboxamide |
| SMILES | CNC(=O)C1(C)CC(Nc2nc(NC)c3c(-c4ccc5nccnc5n4)ccn3n2)C1 |
| InChI | InChI=1S/C21H23N9O/c1-21(19(31)23-3)10-12(11-21)26-20-28-18(22-2)16-13(6-9-30(16)29-20)14-4-5-15-17(27-14)25-8-7-24-15/h4-9,12H,10-11H2,1-3H3,(H,23,31)(H2,22,26,28,29) |
| InChIKey | WCCJRWOJGHBBEQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |