C21H24N8O2 — CID 171550894
1-methyl-4-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxycyclohexan-1-ol (PubChem CID 171550894) has the molecular formula C21H24N8O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is 1-methyl-4-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxycyclohexan-1-ol.
| Compound Name | 1-methyl-4-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 171550894 |
| Molecular Formula | C21H24N8O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-methyl-4-[[4-(methylamino)-5-pyrido[2,3-b]pyrazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxycyclohexan-1-ol |
| SMILES | CNc1nc(NOC2CCC(C)(O)CC2)nn2ccc(-c3ccc4nccnc4n3)c12 |
| InChI | InChI=1S/C21H24N8O2/c1-21(30)8-5-13(6-9-21)31-28-20-26-19(22-2)17-14(7-12-29(17)27-20)15-3-4-16-18(25-15)24-11-10-23-16/h3-4,7,10-13,30H,5-6,8-9H2,1-2H3,(H2,22,26,27,28) |
| InChIKey | VKRHEAGVPAODBP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|