C24H29F3N8O2 — CID 178000953
2-[4-[[4-(methylamino)-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol (PubChem CID 178000953) has the molecular formula C24H29F3N8O2 and a molecular weight of 518.54 g/mol. Its IUPAC name is 2-[4-[[4-(methylamino)-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol.
| Compound Name | 2-[4-[[4-(methylamino)-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol |
|---|---|
| PubChem CID | 178000953 |
| Molecular Formula | C24H29F3N8O2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 2-[4-[[4-(methylamino)-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol |
| SMILES | CNc1nc(NC2CCC(OCCO)CC2)nn2ccc(-c3ccc4nc(C)n(CC(F)(F)F)c4n3)c12 |
| InChI | InChI=1S/C24H29F3N8O2/c1-14-29-19-8-7-18(31-22(19)34(14)13-24(25,26)27)17-9-10-35-20(17)21(28-2)32-23(33-35)30-15-3-5-16(6-4-15)37-12-11-36/h7-10,15-16,36H,3-6,11-13H2,1-2H3,(H2,28,30,32,33) |
| InChIKey | ZZWNLXNUMLMSNT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |