C22H26F2N8O — CID 171733676
5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(3-ethoxycyclobutyl)-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171733676) has the molecular formula C22H26F2N8O and a molecular weight of 456.50 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(3-ethoxycyclobutyl)-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(3-ethoxycyclobutyl)-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171733676 |
| Molecular Formula | C22H26F2N8O |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(3-ethoxycyclobutyl)-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCOC1CC(Nc2nc(NC)c3c(-c4ccc5nc(C)n(CC(F)F)c5n4)ccn3n2)C1 |
| InChI | InChI=1S/C22H26F2N8O/c1-4-33-14-9-13(10-14)27-22-29-20(25-3)19-15(7-8-32(19)30-22)16-5-6-17-21(28-16)31(11-18(23)24)12(2)26-17/h5-8,13-14,18H,4,9-11H2,1-3H3,(H2,25,27,29,30) |
| InChIKey | GWGWDAJMIXLHRM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |