C23H26F2N8O — CID 171551537
5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(1-oxaspiro[3.5]nonan-7-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171551537) has the molecular formula C23H26F2N8O and a molecular weight of 468.51 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(1-oxaspiro[3.5]nonan-7-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(1-oxaspiro[3.5]nonan-7-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171551537 |
| Molecular Formula | C23H26F2N8O |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-(1-oxaspiro[3.5]nonan-7-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | Cc1nc2ccc(-c3ccn4nc(NC5CCC6(CCO6)CC5)nc(N)c34)nc2n1CC(F)F |
| InChI | InChI=1S/C23H26F2N8O/c1-13-27-17-3-2-16(29-21(17)32(13)12-18(24)25)15-6-10-33-19(15)20(26)30-22(31-33)28-14-4-7-23(8-5-14)9-11-34-23/h2-3,6,10,14,18H,4-5,7-9,11-12H2,1H3,(H3,26,28,30,31) |
| InChIKey | CKFDNXLTFNDLSR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |