C27H36F3N9O — CID 171552257
5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-[(3R,4S)-3-fluoro-1-[2-(3-methylbutoxy)ethyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171552257) has the molecular formula C27H36F3N9O and a molecular weight of 559.64 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-[(3R,4S)-3-fluoro-1-[2-(3-methylbutoxy)ethyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-[(3R,4S)-3-fluoro-1-[2-(3-methylbutoxy)ethyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171552257 |
| Molecular Formula | C27H36F3N9O |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-N-[(3R,4S)-3-fluoro-1-[2-(3-methylbutoxy)ethyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | Cc1nc2ccc(-c3ccn4nc(N[C@H]5CCN(CCOCCC(C)C)C[C@H]5F)nc(N)c34)nc2n1CC(F)F |
| InChI | InChI=1S/C27H36F3N9O/c1-16(2)8-12-40-13-11-37-9-7-21(19(28)14-37)34-27-35-25(31)24-18(6-10-39(24)36-27)20-4-5-22-26(33-20)38(15-23(29)30)17(3)32-22/h4-6,10,16,19,21,23H,7-9,11-15H2,1-3H3,(H3,31,34,35,36)/t19-,21+/m1/s1 |
| InChIKey | UFNFSROWAHDRNX-CTNGQTDRSA-N |
| XLogP | 4.18 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|