C24H29F3N8O2 — CID 171552080
2-N-[4-(2-methoxyethoxy)cyclohexyl]-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171552080) has the molecular formula C24H29F3N8O2 and a molecular weight of 518.54 g/mol. Its IUPAC name is 2-N-[4-(2-methoxyethoxy)cyclohexyl]-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[4-(2-methoxyethoxy)cyclohexyl]-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171552080 |
| Molecular Formula | C24H29F3N8O2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 2-N-[4-(2-methoxyethoxy)cyclohexyl]-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | COCCOC1CCC(Nc2nc(N)c3c(-c4ccc5nc(C)n(CC(F)(F)F)c5n4)ccn3n2)CC1 |
| InChI | InChI=1S/C24H29F3N8O2/c1-14-29-19-8-7-18(31-22(19)34(14)13-24(25,26)27)17-9-10-35-20(17)21(28)32-23(33-35)30-15-3-5-16(6-4-15)37-12-11-36-2/h7-10,15-16H,3-6,11-13H2,1-2H3,(H3,28,30,32,33) |
| InChIKey | LTBJALNCTXDTOI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|