C24H33F3N8O — CID 171552180
ethane;1-methylcyclohexan-1-ol;5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171552180) has the molecular formula C24H33F3N8O and a molecular weight of 506.58 g/mol. Its IUPAC name is ethane;1-methylcyclohexan-1-ol;5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | ethane;1-methylcyclohexan-1-ol;5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171552180 |
| Molecular Formula | C24H33F3N8O |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | ethane;1-methylcyclohexan-1-ol;5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CC.CC1(O)CCCCC1.Cc1nc2ccc(-c3ccn4nc(N)nc(N)c34)nc2n1CC(F)(F)F |
| InChI | InChI=1S/C15H13F3N8.C7H14O.C2H6/c1-7-21-10-3-2-9(22-13(10)25(7)6-15(16,17)18)8-4-5-26-11(8)12(19)23-14(20)24-26;1-7(8)5-3-2-4-6-7;1-2/h2-5H,6H2,1H3,(H4,19,20,23,24);8H,2-6H2,1H3;1-2H3 |
| InChIKey | RMYLCMLDJHMOGA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |