C15H12F3N7 — CID 170258178
5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170258178) has the molecular formula C15H12F3N7 and a molecular weight of 347.30 g/mol. Its IUPAC name is 5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170258178 |
| Molecular Formula | C15H12F3N7 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | Cc1nc2ccc(-c3ccn4nc(N)ncc34)nc2n1CC(F)(F)F |
| InChI | InChI=1S/C15H12F3N7/c1-8-21-11-3-2-10(22-13(11)24(8)7-15(16,17)18)9-4-5-25-12(9)6-20-14(19)23-25/h2-6H,7H2,1H3,(H2,19,23) |
| InChIKey | PYFBMGJDWFHXDQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |