C19H19F2N7O — CID 175945833
5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-N-[(3R)-oxolan-3-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 175945833) has the molecular formula C19H19F2N7O and a molecular weight of 399.41 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-N-[(3R)-oxolan-3-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-N-[(3R)-oxolan-3-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 175945833 |
| Molecular Formula | C19H19F2N7O |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-N-[(3R)-oxolan-3-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | Cc1nc2ccc(-c3ccn4nc(N[C@@H]5CCOC5)ncc34)nc2n1CC(F)F |
| InChI | InChI=1S/C19H19F2N7O/c1-11-23-15-3-2-14(25-18(15)27(11)9-17(20)21)13-4-6-28-16(13)8-22-19(26-28)24-12-5-7-29-10-12/h2-4,6,8,12,17H,5,7,9-10H2,1H3,(H,24,26)/t12-/m1/s1 |
| InChIKey | HHSHFCBWGAUSLC-GFCCVEGCSA-N |
| XLogP | 2.92 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |