C20H20F3N9O — CID 171733631
(3R)-3-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpyrrolidin-2-one (PubChem CID 171733631) has the molecular formula C20H20F3N9O and a molecular weight of 459.44 g/mol. Its IUPAC name is (3R)-3-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 171733631 |
| Molecular Formula | C20H20F3N9O |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (3R)-3-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpyrrolidin-2-one |
| SMILES | Cc1nc2ccc(-c3ccn4nc(N[C@@H]5CCN(C)C5=O)nc(N)c34)nc2n1CC(F)(F)F |
| InChI | InChI=1S/C20H20F3N9O/c1-10-25-13-4-3-12(26-17(13)31(10)9-20(21,22)23)11-5-8-32-15(11)16(24)28-19(29-32)27-14-6-7-30(2)18(14)33/h3-5,8,14H,6-7,9H2,1-2H3,(H3,24,27,28,29)/t14-/m1/s1 |
| InChIKey | YQLLCORJKUZLME-CQSZACIVSA-N |
| XLogP | 2.24 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |