C19H20F2N10O — CID 171552079
(3R)-3-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpiperidin-2-one (PubChem CID 171552079) has the molecular formula C19H20F2N10O and a molecular weight of 442.43 g/mol. Its IUPAC name is (3R)-3-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpiperidin-2-one.
| Compound Name | (3R)-3-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 171552079 |
| Molecular Formula | C19H20F2N10O |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (3R)-3-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylpiperidin-2-one |
| SMILES | CN1CCC[C@@H](Nc2nc(N)c3c(-c4ccc5nnn(CC(F)F)c5n4)ccn3n2)C1=O |
| InChI | InChI=1S/C19H20F2N10O/c1-29-7-2-3-13(18(29)32)24-19-25-16(22)15-10(6-8-30(15)27-19)11-4-5-12-17(23-11)31(28-26-12)9-14(20)21/h4-6,8,13-14H,2-3,7,9H2,1H3,(H3,22,24,25,27)/t13-/m1/s1 |
| InChIKey | LVRMHFHWSWZLMC-CYBMUJFWSA-N |
| XLogP | 1.42 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |