C16H15F2N7O — CID 171551250
4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-methylpyrrolo[2,1-f][1,2,4]triazin-7-ol (PubChem CID 171551250) has the molecular formula C16H15F2N7O and a molecular weight of 359.34 g/mol. Its IUPAC name is 4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-methylpyrrolo[2,1-f][1,2,4]triazin-7-ol.
| Compound Name | 4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-methylpyrrolo[2,1-f][1,2,4]triazin-7-ol |
|---|---|
| PubChem CID | 171551250 |
| Molecular Formula | C16H15F2N7O |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-methylpyrrolo[2,1-f][1,2,4]triazin-7-ol |
| SMILES | Cc1nc(N)c2c(-c3ccc4nc(C)n(CC(F)F)c4n3)cc(O)n2n1 |
| InChI | InChI=1S/C16H15F2N7O/c1-7-20-15(19)14-9(5-13(26)25(14)23-7)10-3-4-11-16(22-10)24(6-12(17)18)8(2)21-11/h3-5,12,26H,6H2,1-2H3,(H2,19,20,23) |
| InChIKey | HMXDNGOYNIPADS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |