C23H23F4N9O — CID 171551572
5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-[(E)-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-ylidene]amino]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 171551572) has the molecular formula C23H23F4N9O and a molecular weight of 517.49 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-[(E)-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-ylidene]amino]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-[(E)-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-ylidene]amino]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 171551572 |
| Molecular Formula | C23H23F4N9O |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-2-[(E)-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-ylidene]amino]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1nc2ccc(-c3ccn4nc(/N=C5\CCN(C6COC6)CC5(F)F)nc(N)c34)nc2n1CC(F)F |
| InChI | InChI=1S/C23H23F4N9O/c1-12-29-16-3-2-15(30-21(16)35(12)8-18(24)25)14-4-7-36-19(14)20(28)32-22(33-36)31-17-5-6-34(11-23(17,26)27)13-9-37-10-13/h2-4,7,13,18H,5-6,8-11H2,1H3,(H2,28,32,33)/b31-17+ |
| InChIKey | RWUPNCVWNSTMOC-KBVAKVRCSA-N |
| XLogP | 3.11 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|