C23H27FN8O — CID 171551735
2-N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171551735) has the molecular formula C23H27FN8O and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171551735 |
| Molecular Formula | C23H27FN8O |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CNc1nc(N[C@H]2CCN(CCOC)C[C@@H]2F)nn2ccc(-c3ccc4ncccc4n3)c12 |
| InChI | InChI=1S/C23H27FN8O/c1-25-22-21-15(17-5-6-19-20(27-17)4-3-9-26-19)7-11-32(21)30-23(29-22)28-18-8-10-31(12-13-33-2)14-16(18)24/h3-7,9,11,16,18H,8,10,12-14H2,1-2H3,(H2,25,28,29,30)/t16-,18-/m0/s1 |
| InChIKey | KFELHRXHJGAAAL-WMZOPIPTSA-N |
| XLogP | 2.85 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |