C30H45F2N7 — CID 171552312
1-(2-cyclopropylethyl)-1-methylcyclohexane;1,1-difluoropropane;5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171552312) has the molecular formula C30H45F2N7 and a molecular weight of 541.74 g/mol. Its IUPAC name is 1-(2-cyclopropylethyl)-1-methylcyclohexane;1,1-difluoropropane;5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 1-(2-cyclopropylethyl)-1-methylcyclohexane;1,1-difluoropropane;5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171552312 |
| Molecular Formula | C30H45F2N7 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | 1-(2-cyclopropylethyl)-1-methylcyclohexane;1,1-difluoropropane;5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CC(C)=Nc1ccc(-c2ccn3nc(N)nc(N)c23)nc1C.CC1(CCC2CC2)CCCCC1.CCC(F)F |
| InChI | InChI=1S/C15H17N7.C12H22.C3H6F2/c1-8(2)18-11-4-5-12(19-9(11)3)10-6-7-22-13(10)14(16)20-15(17)21-22;1-12(8-3-2-4-9-12)10-7-11-5-6-11;1-2-3(4)5/h4-7H,1-3H3,(H4,16,17,20,21);11H,2-10H2,1H3;3H,2H2,1H3 |
| InChIKey | YCFMCCLJVKCRNQ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|