C20H21F3N6O5S — CID 171553045
6-[3-(2,2-difluoroethoxy)pyrazin-2-yl]oxy-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 171553045) has the molecular formula C20H21F3N6O5S and a molecular weight of 514.49 g/mol. Its IUPAC name is 6-[3-(2,2-difluoroethoxy)pyrazin-2-yl]oxy-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 6-[3-(2,2-difluoroethoxy)pyrazin-2-yl]oxy-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171553045 |
| Molecular Formula | C20H21F3N6O5S |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 6-[3-(2,2-difluoroethoxy)pyrazin-2-yl]oxy-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | Cc1c(Oc2nccnc2OCC(F)F)cc(F)c2nc(C(=O)NC3(C)CCS(=O)(=O)CC3)nn12 |
| InChI | InChI=1S/C20H21F3N6O5S/c1-11-13(34-19-18(24-5-6-25-19)33-10-14(22)23)9-12(21)16-26-15(28-29(11)16)17(30)27-20(2)3-7-35(31,32)8-4-20/h5-6,9,14H,3-4,7-8,10H2,1-2H3,(H,27,30) |
| InChIKey | WZPCVFYXRFUMNT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |