C34H39NO2S — CID 171554077
(2S)-2-[methyl-[[4-[3-(3-octylthiophen-2-yl)phenyl]phenyl]methyl]amino]-2-phenylacetic acid (PubChem CID 171554077) has the molecular formula C34H39NO2S and a molecular weight of 525.76 g/mol. Its IUPAC name is (2S)-2-[methyl-[[4-[3-(3-octylthiophen-2-yl)phenyl]phenyl]methyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[methyl-[[4-[3-(3-octylthiophen-2-yl)phenyl]phenyl]methyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 171554077 |
| Molecular Formula | C34H39NO2S |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | (2S)-2-[methyl-[[4-[3-(3-octylthiophen-2-yl)phenyl]phenyl]methyl]amino]-2-phenylacetic acid |
| SMILES | CCCCCCCCc1ccsc1-c1cccc(-c2ccc(CN(C)[C@H](C(=O)O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C34H39NO2S/c1-3-4-5-6-7-9-15-29-22-23-38-33(29)31-17-12-16-30(24-31)27-20-18-26(19-21-27)25-35(2)32(34(36)37)28-13-10-8-11-14-28/h8,10-14,16-24,32H,3-7,9,15,25H2,1-2H3,(H,36,37)/t32-/m0/s1 |
| InChIKey | JEJXPNCBBLJOSQ-YTTGMZPUSA-N |
| XLogP | 9.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|