C24H41N3O3 — CID 171554323
ethane;4-methyl-1-[4-[3-[[5-(2-oxobutyl)-2-pyridinyl]oxy]propyl]piperazin-1-yl]pentan-1-one (PubChem CID 171554323) has the molecular formula C24H41N3O3 and a molecular weight of 419.61 g/mol. Its IUPAC name is ethane;4-methyl-1-[4-[3-[[5-(2-oxobutyl)-2-pyridinyl]oxy]propyl]piperazin-1-yl]pentan-1-one.
| Compound Name | ethane;4-methyl-1-[4-[3-[[5-(2-oxobutyl)-2-pyridinyl]oxy]propyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 171554323 |
| Molecular Formula | C24H41N3O3 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | ethane;4-methyl-1-[4-[3-[[5-(2-oxobutyl)-2-pyridinyl]oxy]propyl]piperazin-1-yl]pentan-1-one |
| SMILES | CC.CCC(=O)Cc1ccc(OCCCN2CCN(C(=O)CCC(C)C)CC2)nc1 |
| InChI | InChI=1S/C22H35N3O3.C2H6/c1-4-20(26)16-19-7-8-21(23-17-19)28-15-5-10-24-11-13-25(14-12-24)22(27)9-6-18(2)3;1-2/h7-8,17-18H,4-6,9-16H2,1-3H3;1-2H3 |
| InChIKey | FPXHKAZWYCJPQH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|