C17H23N3O2S — CID 171554541
N-methyl-N-[2-[methyl(sulfanyl)amino]-6-(3-piperidin-4-yloxyprop-1-ynyl)phenyl]formamide (PubChem CID 171554541) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-methyl-N-[2-[methyl(sulfanyl)amino]-6-(3-piperidin-4-yloxyprop-1-ynyl)phenyl]formamide.
| Compound Name | N-methyl-N-[2-[methyl(sulfanyl)amino]-6-(3-piperidin-4-yloxyprop-1-ynyl)phenyl]formamide |
|---|---|
| PubChem CID | 171554541 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-methyl-N-[2-[methyl(sulfanyl)amino]-6-(3-piperidin-4-yloxyprop-1-ynyl)phenyl]formamide |
| SMILES | CN(S)c1cccc(C#CCOC2CCNCC2)c1N(C)C=O |
| InChI | InChI=1S/C17H23N3O2S/c1-19(13-21)17-14(5-3-7-16(17)20(2)23)6-4-12-22-15-8-10-18-11-9-15/h3,5,7,13,15,18,23H,8-12H2,1-2H3 |
| InChIKey | MOCVWZAUWUQMPF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|