C17H27N3O3 — CID 67170278
tert-butyl (2R)-2-[(2-amino-4-methylanilino)methyl]morpholine-4-carboxylate (PubChem CID 67170278) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-amino-4-methylanilino)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(2-amino-4-methylanilino)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 67170278 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl (2R)-2-[(2-amino-4-methylanilino)methyl]morpholine-4-carboxylate |
| SMILES | Cc1ccc(NC[C@@H]2CN(C(=O)OC(C)(C)C)CCO2)c(N)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-12-5-6-15(14(18)9-12)19-10-13-11-20(7-8-22-13)16(21)23-17(2,3)4/h5-6,9,13,19H,7-8,10-11,18H2,1-4H3/t13-/m1/s1 |
| InChIKey | OVRBKEFYHMHZTJ-CYBMUJFWSA-N |
| XLogP | 2.63 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|