C21H26N4O — CID 171555281
8-[(E)-2-ethoxyethenyl]-3-(4-methyl-2-propyl-1,2-dihydropyridin-5-yl)-1,6-naphthyridin-7-amine (PubChem CID 171555281) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 8-[(E)-2-ethoxyethenyl]-3-(4-methyl-2-propyl-1,2-dihydropyridin-5-yl)-1,6-naphthyridin-7-amine.
| Compound Name | 8-[(E)-2-ethoxyethenyl]-3-(4-methyl-2-propyl-1,2-dihydropyridin-5-yl)-1,6-naphthyridin-7-amine |
|---|---|
| PubChem CID | 171555281 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 8-[(E)-2-ethoxyethenyl]-3-(4-methyl-2-propyl-1,2-dihydropyridin-5-yl)-1,6-naphthyridin-7-amine |
| SMILES | CCCC1C=C(C)C(c2cnc3c(/C=C/OCC)c(N)ncc3c2)=CN1 |
| InChI | InChI=1S/C21H26N4O/c1-4-6-17-9-14(3)19(13-23-17)15-10-16-12-25-21(22)18(7-8-26-5-2)20(16)24-11-15/h7-13,17,23H,4-6H2,1-3H3,(H2,22,25)/b8-7+ |
| InChIKey | MUOBERDYQBOHPE-BQYQJAHWSA-N |
| XLogP | 4.28 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|