C23H22FN5O2 — CID 171555725
N-[6-cyano-7-[2-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4-methyl-1,2-dihydropyridin-5-yl]isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 171555725) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is N-[6-cyano-7-[2-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4-methyl-1,2-dihydropyridin-5-yl]isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | N-[6-cyano-7-[2-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4-methyl-1,2-dihydropyridin-5-yl]isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171555725 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[6-cyano-7-[2-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4-methyl-1,2-dihydropyridin-5-yl]isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | CC/C(=N/O)C1C=C(C)C(c2cc3cnc(NC(=O)C4CC4F)cc3cc2C#N)=CN1 |
| InChI | InChI=1S/C23H22FN5O2/c1-3-20(29-31)21-4-12(2)18(11-26-21)16-6-15-10-27-22(7-13(15)5-14(16)9-25)28-23(30)17-8-19(17)24/h4-7,10-11,17,19,21,26,31H,3,8H2,1-2H3,(H,27,28,30)/b29-20- |
| InChIKey | UBTAXGDYJKQRHR-BRPDVVIDSA-N |
| XLogP | 3.90 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|